C20H18N2 — CID 134447803
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylbenzimidazole (PubChem CID 134447803) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylbenzimidazole.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylbenzimidazole |
|---|---|
| PubChem CID | 134447803 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-phenylbenzimidazole |
| SMILES | C=C/C=C(\C=C/C)n1c(-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C20H18N2/c1-3-10-17(11-4-2)22-19-15-9-8-14-18(19)21-20(22)16-12-6-5-7-13-16/h3-15H,1H2,2H3/b11-4-,17-10+ |
| InChIKey | JYDNHKPMSZHBCO-XANQEJEYSA-N |
| XLogP | 5.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|