C19H18N4 — CID 154648335
9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-8-phenylpurine (PubChem CID 154648335) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-8-phenylpurine.
| Compound Name | 9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-8-phenylpurine |
|---|---|
| PubChem CID | 154648335 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-8-phenylpurine |
| SMILES | C/C=C\C=C(/C=C\C)n1c(-c2ccccc2)nc2cncnc21 |
| InChI | InChI=1S/C19H18N4/c1-3-5-12-16(9-4-2)23-18(15-10-7-6-8-11-15)22-17-13-20-14-21-19(17)23/h3-14H,1-2H3/b5-3-,9-4-,16-12+ |
| InChIKey | YEPRXVMSVSDYFX-WVZINWSFSA-N |
| XLogP | 4.49 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|