C32H28BN — CID 144597046
[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylcarbazol-3-yl]-diphenylborane (PubChem CID 144597046) has the molecular formula C32H28BN and a molecular weight of 437.40 g/mol. Its IUPAC name is [9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylcarbazol-3-yl]-diphenylborane.
| Compound Name | [9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylcarbazol-3-yl]-diphenylborane |
|---|---|
| PubChem CID | 144597046 |
| Molecular Formula | C32H28BN |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylcarbazol-3-yl]-diphenylborane |
| SMILES | C=C/C=C(\C=C/C)n1c2ccc(C)cc2c2cc(B(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C32H28BN/c1-4-12-28(13-5-2)34-31-20-18-24(3)22-29(31)30-23-27(19-21-32(30)34)33(25-14-8-6-9-15-25)26-16-10-7-11-17-26/h4-23H,1H2,2-3H3/b13-5-,28-12+ |
| InChIKey | BSESXTBOWMWUCL-SWKUFGQJSA-N |
| XLogP | 6.22 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|