C34H35N — CID 153369792
9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[4-methyl-3-[(4Z)-2-methylhepta-2,4-dien-3-yl]phenyl]carbazole (PubChem CID 153369792) has the molecular formula C34H35N and a molecular weight of 457.66 g/mol. Its IUPAC name is 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[4-methyl-3-[(4Z)-2-methylhepta-2,4-dien-3-yl]phenyl]carbazole.
| Compound Name | 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[4-methyl-3-[(4Z)-2-methylhepta-2,4-dien-3-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 153369792 |
| Molecular Formula | C34H35N |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[4-methyl-3-[(4Z)-2-methylhepta-2,4-dien-3-yl]phenyl]carbazole |
| SMILES | C=C/C=C(\C=C/C)n1c2ccccc2c2cc(-c3ccc(C)c(C(/C=C\CC)=C(C)C)c3)ccc21 |
| InChI | InChI=1S/C34H35N/c1-7-10-15-29(24(4)5)31-22-26(19-18-25(31)6)27-20-21-34-32(23-27)30-16-11-12-17-33(30)35(34)28(13-8-2)14-9-3/h8-23H,2,7H2,1,3-6H3/b14-9-,15-10-,28-13+ |
| InChIKey | QGUSSNYUTKBUMU-DDEZCVCMSA-N |
| XLogP | 10.13 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|