C25H19BN — CID 174098939
CID 174098939 (PubChem CID 174098939) has the molecular formula C25H19BN and a molecular weight of 344.25 g/mol.
| Compound Name | CID 174098939 |
|---|---|
| PubChem CID | 174098939 |
| Molecular Formula | C25H19BN |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | — |
| SMILES | C=C/C=C(\C=C/C)n1c2ccccc2c2cc3c(cc21)-c1ccccc1[B]3 |
| InChI | InChI=1S/C25H19BN/c1-3-9-17(10-4-2)27-24-14-8-6-12-19(24)21-15-23-20(16-25(21)27)18-11-5-7-13-22(18)26-23/h3-16H,1H2,2H3/b10-4-,17-9+ |
| InChIKey | WGFDPLWRILGXBN-JVLVOZANSA-N |
| XLogP | 5.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|