C46H34N4O — CID 144956041
3-[9-(2,6-dipyridin-2-yl-4-pyridinyl)-2,3-dihydrodibenzofuran-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole (PubChem CID 144956041) has the molecular formula C46H34N4O and a molecular weight of 658.81 g/mol. Its IUPAC name is 3-[9-(2,6-dipyridin-2-yl-4-pyridinyl)-2,3-dihydrodibenzofuran-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole.
| Compound Name | 3-[9-(2,6-dipyridin-2-yl-4-pyridinyl)-2,3-dihydrodibenzofuran-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole |
|---|---|
| PubChem CID | 144956041 |
| Molecular Formula | C46H34N4O |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 3-[9-(2,6-dipyridin-2-yl-4-pyridinyl)-2,3-dihydrodibenzofuran-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole |
| SMILES | C=C/C=C(\C=C/C)n1c2ccccc2c2cc(C3C=c4c(oc5cccc(-c6cc(-c7ccccn7)nc(-c7ccccn7)c6)c45)=CC3)ccc21 |
| InChI | InChI=1S/C46H34N4O/c1-3-12-33(13-4-2)50-42-18-6-5-14-35(42)36-26-30(20-22-43(36)50)31-21-23-44-37(27-31)46-34(15-11-19-45(46)51-44)32-28-40(38-16-7-9-24-47-38)49-41(29-32)39-17-8-10-25-48-39/h3-20,22-29,31H,1,21H2,2H3/b13-4-,33-12+ |
| InChIKey | GJRHNWNPSOOJHM-HRDDCWLHSA-N |
| XLogP | 10.08 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|