C47H36N2O — CID 144956035
1-[8-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-3-yl]dibenzofuran-1-yl]-N-methyl-3,3-diphenylprop-2-en-1-imine (PubChem CID 144956035) has the molecular formula C47H36N2O and a molecular weight of 644.82 g/mol. Its IUPAC name is 1-[8-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-3-yl]dibenzofuran-1-yl]-N-methyl-3,3-diphenylprop-2-en-1-imine.
| Compound Name | 1-[8-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-3-yl]dibenzofuran-1-yl]-N-methyl-3,3-diphenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 144956035 |
| Molecular Formula | C47H36N2O |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 1-[8-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-3-yl]dibenzofuran-1-yl]-N-methyl-3,3-diphenylprop-2-en-1-imine |
| SMILES | C=C/C=C(\C=C/C)n1c2ccccc2c2cc(-c3ccc4oc5cccc(/C(C=C(c6ccccc6)c6ccccc6)=N\C)c5c4c3)ccc21 |
| InChI | InChI=1S/C47H36N2O/c1-4-15-36(16-5-2)49-43-23-13-12-21-37(43)40-29-34(25-27-44(40)49)35-26-28-45-41(30-35)47-38(22-14-24-46(47)50-45)42(48-3)31-39(32-17-8-6-9-18-32)33-19-10-7-11-20-33/h4-31H,1H2,2-3H3/b16-5-,36-15+,48-42- |
| InChIKey | WLVVUELLBAWKCS-XBUAQCCZSA-N |
| XLogP | 12.51 |
| TPSA | 30.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|