C32H27N3 — CID 144614568
N-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-4-yl]-9-methylcarbazol-1-amine (PubChem CID 144614568) has the molecular formula C32H27N3 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-4-yl]-9-methylcarbazol-1-amine.
| Compound Name | N-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-4-yl]-9-methylcarbazol-1-amine |
|---|---|
| PubChem CID | 144614568 |
| Molecular Formula | C32H27N3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazol-4-yl]-9-methylcarbazol-1-amine |
| SMILES | C=C/C=C(\C=C/C)n1c2ccccc2c2c(Nc3cccc4c5ccccc5n(C)c34)cccc21 |
| InChI | InChI=1S/C32H27N3/c1-4-12-22(13-5-2)35-29-20-9-7-15-25(29)31-26(17-11-21-30(31)35)33-27-18-10-16-24-23-14-6-8-19-28(23)34(3)32(24)27/h4-21,33H,1H2,2-3H3/b13-5-,22-12+ |
| InChIKey | MKHILXPFUWCKTQ-JWDBVLSBSA-N |
| XLogP | 8.79 |
| TPSA | 21.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|