C48H38N2 — CID 145381399
3-[4-[2-ethenyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(Z)-prop-1-enyl]indol-5-yl]phenyl]-9-naphthalen-2-ylcarbazole (PubChem CID 145381399) has the molecular formula C48H38N2 and a molecular weight of 642.85 g/mol. Its IUPAC name is 3-[4-[2-ethenyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(Z)-prop-1-enyl]indol-5-yl]phenyl]-9-naphthalen-2-ylcarbazole.
| Compound Name | 3-[4-[2-ethenyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(Z)-prop-1-enyl]indol-5-yl]phenyl]-9-naphthalen-2-ylcarbazole |
|---|---|
| PubChem CID | 145381399 |
| Molecular Formula | C48H38N2 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 3-[4-[2-ethenyl-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(Z)-prop-1-enyl]indol-5-yl]phenyl]-9-naphthalen-2-ylcarbazole |
| SMILES | C=C/C=C(\C=C/C)n1c(C=C)c(/C=C\C)c2cc(-c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccc5ccccc5c4)cc3)ccc21 |
| InChI | InChI=1S/C48H38N2/c1-5-13-39(14-6-2)49-45(8-4)41(15-7-3)43-31-37(25-28-47(43)49)34-20-22-35(23-21-34)38-26-29-48-44(32-38)42-18-11-12-19-46(42)50(48)40-27-24-33-16-9-10-17-36(33)30-40/h5-32H,1,4H2,2-3H3/b14-6-,15-7-,39-13+ |
| InChIKey | KVKDGKXQERMEDA-LSXDEZNTSA-N |
| XLogP | 13.50 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|