C37H26Br2N2 — CID 145163222
9-(3,5-dibromophenyl)-3-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]carbazole (PubChem CID 145163222) has the molecular formula C37H26Br2N2 and a molecular weight of 658.44 g/mol. Its IUPAC name is 9-(3,5-dibromophenyl)-3-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]carbazole.
| Compound Name | 9-(3,5-dibromophenyl)-3-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]carbazole |
|---|---|
| PubChem CID | 145163222 |
| Molecular Formula | C37H26Br2N2 |
| Molecular Weight | 658.44 g/mol |
| Exact Mass | 656.05 |
| IUPAC Name | 9-(3,5-dibromophenyl)-3-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]carbazole |
| SMILES | C=Cc1c(/C=C\C)c2cc(-c3ccc4c(c3)c3ccccc3n4-c3cc(Br)cc(Br)c3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C37H26Br2N2/c1-3-10-30-32-19-24(15-17-36(32)40(34(30)4-2)28-11-6-5-7-12-28)25-16-18-37-33(20-25)31-13-8-9-14-35(31)41(37)29-22-26(38)21-27(39)23-29/h3-23H,2H2,1H3/b10-3- |
| InChIKey | YTRNLXOBQZEJTE-KMKOMSMNSA-N |
| XLogP | 11.60 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.44 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |