C53H48N4 — CID 123672948
1-hepta-1,3,5-trien-4-yl-2-[2-(1-hepta-1,3,5-trien-4-ylbenzimidazol-2-yl)-4,6,6,12,12-pentamethylindeno[1,2-b]fluoren-8-yl]benzimidazole (PubChem CID 123672948) has the molecular formula C53H48N4 and a molecular weight of 741.00 g/mol. Its IUPAC name is 1-hepta-1,3,5-trien-4-yl-2-[2-(1-hepta-1,3,5-trien-4-ylbenzimidazol-2-yl)-4,6,6,12,12-pentamethylindeno[1,2-b]fluoren-8-yl]benzimidazole.
| Compound Name | 1-hepta-1,3,5-trien-4-yl-2-[2-(1-hepta-1,3,5-trien-4-ylbenzimidazol-2-yl)-4,6,6,12,12-pentamethylindeno[1,2-b]fluoren-8-yl]benzimidazole |
|---|---|
| PubChem CID | 123672948 |
| Molecular Formula | C53H48N4 |
| Molecular Weight | 741.00 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | 1-hepta-1,3,5-trien-4-yl-2-[2-(1-hepta-1,3,5-trien-4-ylbenzimidazol-2-yl)-4,6,6,12,12-pentamethylindeno[1,2-b]fluoren-8-yl]benzimidazole |
| SMILES | C=CC=C(C=CC)n1c(-c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(-c3nc5ccccc5n3C(C=CC)=CC=C)cc(C)c2-4)nc2ccccc21 |
| InChI | InChI=1S/C53H48N4/c1-10-18-36(19-11-2)56-47-24-16-14-22-45(47)54-50(56)34-26-27-38-39-31-43-40(32-42(39)52(6,7)41(38)29-34)49-33(5)28-35(30-44(49)53(43,8)9)51-55-46-23-15-17-25-48(46)57(51)37(20-12-3)21-13-4/h10-32H,1,3H2,2,4-9H3 |
| InChIKey | CPIWFQADURQNDP-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.00 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|