C13H12N2O — CID 170405322
(5E)-N-ethenyl-5-ethylidene-2-phenyl-1,3-oxazol-4-imine (PubChem CID 170405322) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is (5E)-N-ethenyl-5-ethylidene-2-phenyl-1,3-oxazol-4-imine.
| Compound Name | (5E)-N-ethenyl-5-ethylidene-2-phenyl-1,3-oxazol-4-imine |
|---|---|
| PubChem CID | 170405322 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (5E)-N-ethenyl-5-ethylidene-2-phenyl-1,3-oxazol-4-imine |
| SMILES | C=C/N=C1\N=C(c2ccccc2)O\C1=C\C |
| InChI | InChI=1S/C13H12N2O/c1-3-11-12(14-4-2)15-13(16-11)10-8-6-5-7-9-10/h3-9H,2H2,1H3/b11-3+,14-12- |
| InChIKey | QYAYCVJHTLVXKH-JGBGOQPFSA-N |
| XLogP | 2.91 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|