C14H12CuN2O4 — CID 131881800
copper bis((6Z)-4-methyl-6-oxidoiminocyclohexa-2,4-dien-1-one) (PubChem CID 131881800) has the molecular formula C14H12CuN2O4 and a molecular weight of 335.81 g/mol. Its IUPAC name is copper bis((6Z)-4-methyl-6-oxidoiminocyclohexa-2,4-dien-1-one).
| Compound Name | copper bis((6Z)-4-methyl-6-oxidoiminocyclohexa-2,4-dien-1-one) |
|---|---|
| PubChem CID | 131881800 |
| Molecular Formula | C14H12CuN2O4 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | copper bis((6Z)-4-methyl-6-oxidoiminocyclohexa-2,4-dien-1-one) |
| SMILES | CC1=C/C(=N/[O-])C(=O)C=C1.CC1=C/C(=N/[O-])C(=O)C=C1.[Cu+2] |
| InChI | InChI=1S/2C7H7NO2.Cu/c2*1-5-2-3-7(9)6(4-5)8-10;/h2*2-4,10H,1H3;/q;;+2/p-2/b2*8-6-; |
| InChIKey | ZWGUGMSWHCTUCK-HIGYRTBYSA-L |
| XLogP | 2.02 |
| TPSA | 104.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|