C8H8KNO2 — CID 21236093
potassium 2,6-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one (PubChem CID 21236093) has the molecular formula C8H8KNO2 and a molecular weight of 189.25 g/mol. Its IUPAC name is potassium 2,6-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one.
| Compound Name | potassium 2,6-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 21236093 |
| Molecular Formula | C8H8KNO2 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | potassium 2,6-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=N[O-])C=C(C)C1=O.[K+] |
| InChI | InChI=1S/C8H9NO2.K/c1-5-3-7(9-11)4-6(2)8(5)10;/h3-4,11H,1-2H3;/q;+1/p-1 |
| InChIKey | SLGYNIYJWJZKBF-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|