C8H8LiNO2 — CID 21239746
lithium 3,5-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one (PubChem CID 21239746) has the molecular formula C8H8LiNO2 and a molecular weight of 157.10 g/mol. Its IUPAC name is lithium 3,5-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one.
| Compound Name | lithium 3,5-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 21239746 |
| Molecular Formula | C8H8LiNO2 |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | lithium 3,5-dimethyl-4-oxidoiminocyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=O)C=C(C)C1=N[O-].[Li+] |
| InChI | InChI=1S/C8H9NO2.Li/c1-5-3-7(10)4-6(2)8(5)9-11;/h3-4,11H,1-2H3;/q;+1/p-1 |
| InChIKey | JXZPDGMEBSNMSB-UHFFFAOYSA-M |
| XLogP | -1.60 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|