C14H20NNaO2 — CID 23711450
sodium 2,6-ditert-butyl-4-oxidoiminocyclohexa-2,5-dien-1-one (PubChem CID 23711450) has the molecular formula C14H20NNaO2 and a molecular weight of 257.31 g/mol. Its IUPAC name is sodium 2,6-ditert-butyl-4-oxidoiminocyclohexa-2,5-dien-1-one.
| Compound Name | sodium 2,6-ditert-butyl-4-oxidoiminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 23711450 |
| Molecular Formula | C14H20NNaO2 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | sodium 2,6-ditert-butyl-4-oxidoiminocyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=N[O-])C=C(C(C)(C)C)C1=O.[Na+] |
| InChI | InChI=1S/C14H21NO2.Na/c1-13(2,3)10-7-9(15-17)8-11(12(10)16)14(4,5)6;/h7-8,17H,1-6H3;/q;+1/p-1 |
| InChIKey | FHOVUFKIBRMBJG-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|