C21H25NO4 — CID 171977268
[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 171977268) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 171977268 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(C)(C)C1=CC(=NOC(=O)/C=C/c2ccco2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C21H25NO4/c1-20(2,3)16-12-14(13-17(19(16)24)21(4,5)6)22-26-18(23)10-9-15-8-7-11-25-15/h7-13H,1-6H3/b10-9+ |
| InChIKey | LTHQFWCTSPSWPE-MDZDMXLPSA-N |
| XLogP | 4.72 |
| TPSA | 68.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|