C12H16O3 — CID 56972286
3-methylbutyl (Z)-3-(furan-2-yl)prop-2-enoate (PubChem CID 56972286) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-methylbutyl (Z)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | 3-methylbutyl (Z)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 56972286 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-methylbutyl (Z)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(C)CCOC(=O)/C=C\c1ccco1 |
| InChI | InChI=1S/C12H16O3/c1-10(2)7-9-15-12(13)6-5-11-4-3-8-14-11/h3-6,8,10H,7,9H2,1-2H3/b6-5- |
| InChIKey | XAPDJXISYPRRFW-WAYWQWQTSA-N |
| XLogP | 2.88 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|