C12H18ClNO3 — CID 44655635
3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl-dimethylazanium chloride (PubChem CID 44655635) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl-dimethylazanium chloride.
| Compound Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 44655635 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCCOC(=O)/C=C/c1ccco1.[Cl-] |
| InChI | InChI=1S/C12H17NO3.ClH/c1-13(2)8-4-10-16-12(14)7-6-11-5-3-9-15-11;/h3,5-7,9H,4,8,10H2,1-2H3;1H/b7-6+; |
| InChIKey | NHPBMOYNXVBQLY-UHDJGPCESA-N |
| XLogP | -2.63 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|