C34H32O12 — CID 70001163
2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate;3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 70001163) has the molecular formula C34H32O12 and a molecular weight of 632.62 g/mol. Its IUPAC name is 2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate;3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | 2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate;3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 70001163 |
| Molecular Formula | C34H32O12 |
| Molecular Weight | 632.62 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 2-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate;3-[(E)-3-(furan-2-yl)prop-2-enoyl]oxypropyl (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(COC(=O)/C=C/c1ccco1)OC(=O)/C=C/c1ccco1.O=C(/C=C/c1ccco1)OCCCOC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/2C17H16O6/c1-13(23-17(19)9-7-15-5-3-11-21-15)12-22-16(18)8-6-14-4-2-10-20-14;18-16(8-6-14-4-1-10-20-14)22-12-3-13-23-17(19)9-7-15-5-2-11-21-15/h2-11,13H,12H2,1H3;1-2,4-11H,3,12-13H2/b2*8-6+,9-7+ |
| InChIKey | SAZWOPZUAUNCGD-VTNWEUQQSA-N |
| XLogP | 6.15 |
| TPSA | 157.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|