C22H16O5 — CID 2423576
(1,3-dioxo-1,3-diphenylpropan-2-yl) (Z)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2423576) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is (1,3-dioxo-1,3-diphenylpropan-2-yl) (Z)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | (1,3-dioxo-1,3-diphenylpropan-2-yl) (Z)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2423576 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (1,3-dioxo-1,3-diphenylpropan-2-yl) (Z)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C\c1ccco1)OC(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16O5/c23-19(14-13-18-12-7-15-26-18)27-22(20(24)16-8-3-1-4-9-16)21(25)17-10-5-2-6-11-17/h1-15,22H/b14-13- |
| InChIKey | MOJKTSKFXSQWHB-YPKPFQOOSA-N |
| XLogP | 3.97 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|