C14H21NO4 — CID 82532597
2-[2-(propylamino)ethoxy]ethyl (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 82532597) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-[2-(propylamino)ethoxy]ethyl (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | 2-[2-(propylamino)ethoxy]ethyl (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 82532597 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-[2-(propylamino)ethoxy]ethyl (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CCCNCCOCCOC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C14H21NO4/c1-2-7-15-8-10-17-11-12-19-14(16)6-5-13-4-3-9-18-13/h3-6,9,15H,2,7-8,10-12H2,1H3/b6-5+ |
| InChIKey | UXOXOFNJAWKSQU-AATRIKPKSA-N |
| XLogP | 1.85 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|