C20H24N2O3 — CID 134924354
2,6-ditert-butyl-4-(4-nitrophenyl)iminocyclohexa-2,5-dien-1-one (PubChem CID 134924354) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(4-nitrophenyl)iminocyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-(4-nitrophenyl)iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 134924354 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2,6-ditert-butyl-4-(4-nitrophenyl)iminocyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=Nc2ccc([N+](=O)[O-])cc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C20H24N2O3/c1-19(2,3)16-11-14(12-17(18(16)23)20(4,5)6)21-13-7-9-15(10-8-13)22(24)25/h7-12H,1-6H3 |
| InChIKey | KBIAADLSEVDTTH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|