C15H13NO2 — CID 5089876
N-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide (PubChem CID 5089876) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide.
| Compound Name | N-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide |
|---|---|
| PubChem CID | 5089876 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide |
| SMILES | CC1=CC(=NC(=O)c2ccccc2)C=C(C)C1=O |
| InChI | InChI=1S/C15H13NO2/c1-10-8-13(9-11(2)14(10)17)16-15(18)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | MMAAXSSQLCASML-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|