C8H10N2 — CID 143711928
(2Z,4Z,7Z)-4-methyl-6-methylidene-1H-diazocine (PubChem CID 143711928) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (2Z,4Z,7Z)-4-methyl-6-methylidene-1H-diazocine.
| Compound Name | (2Z,4Z,7Z)-4-methyl-6-methylidene-1H-diazocine |
|---|---|
| PubChem CID | 143711928 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (2Z,4Z,7Z)-4-methyl-6-methylidene-1H-diazocine |
| SMILES | C=C1/C=C\N/N=C\C(C)=C/1 |
| InChI | InChI=1S/C8H10N2/c1-7-3-4-9-10-6-8(2)5-7/h3-6,9H,1H2,2H3/b4-3-,8-5-,10-6- |
| InChIKey | SXMOLKSODYPWNG-DLHYRDGDSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |