C7H8I- — CID 163460635
5-methylidene-2-methyliodanuidylcyclopenta-1,3-diene (PubChem CID 163460635) has the molecular formula C7H8I- and a molecular weight of 219.04 g/mol. Its IUPAC name is 5-methylidene-2-methyliodanuidylcyclopenta-1,3-diene.
| Compound Name | 5-methylidene-2-methyliodanuidylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 163460635 |
| Molecular Formula | C7H8I- |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | 5-methylidene-2-methyliodanuidylcyclopenta-1,3-diene |
| SMILES | C=C1C=CC([I-]C)=C1 |
| InChI | InChI=1S/C7H8I/c1-6-3-4-7(5-6)8-2/h3-5H,1H2,2H3/q-1 |
| InChIKey | OHSPBBPPUVJBFD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|