C7H6Cl2 — CID 135469084
1,6-dichloro-3-methylidenecyclohexa-1,4-diene (PubChem CID 135469084) has the molecular formula C7H6Cl2 and a molecular weight of 161.03 g/mol. Its IUPAC name is 1,6-dichloro-3-methylidenecyclohexa-1,4-diene.
| Compound Name | 1,6-dichloro-3-methylidenecyclohexa-1,4-diene |
|---|---|
| PubChem CID | 135469084 |
| Molecular Formula | C7H6Cl2 |
| Molecular Weight | 161.03 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | 1,6-dichloro-3-methylidenecyclohexa-1,4-diene |
| SMILES | C=C1C=CC(Cl)C(Cl)=C1 |
| InChI | InChI=1S/C7H6Cl2/c1-5-2-3-6(8)7(9)4-5/h2-4,6H,1H2 |
| InChIKey | BGCICQIKZZQWIX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|