C15H16Cl2KNOS — CID 143396087
potassium;2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-olate;ethane (PubChem CID 143396087) has the molecular formula C15H16Cl2KNOS and a molecular weight of 368.37 g/mol. Its IUPAC name is potassium;2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-olate;ethane.
| Compound Name | potassium;2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-olate;ethane |
|---|---|
| PubChem CID | 143396087 |
| Molecular Formula | C15H16Cl2KNOS |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | potassium;2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-olate;ethane |
| SMILES | CC.[H]/N=C(\C)c1csc(C2=CC=C(Cl)C(Cl)C=C2)c1[O-].[K+] |
| InChI | InChI=1S/C13H11Cl2NOS.C2H6.K/c1-7(16)9-6-18-13(12(9)17)8-2-4-10(14)11(15)5-3-8;1-2;/h2-6,10,16-17H,1H3;1-2H3;/q;;+1/p-1/b16-7+;; |
| InChIKey | IBTIGHLWLHWYBR-WHYKZYOGSA-M |
| XLogP | 1.92 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|