C13H11Cl2NOS — CID 143396088
2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-ol (PubChem CID 143396088) has the molecular formula C13H11Cl2NOS and a molecular weight of 300.21 g/mol. Its IUPAC name is 2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-ol.
| Compound Name | 2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-ol |
|---|---|
| PubChem CID | 143396088 |
| Molecular Formula | C13H11Cl2NOS |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-(4,5-dichlorocyclohepta-1,3,6-trien-1-yl)-4-ethanimidoylthiophen-3-ol |
| SMILES | [H]/N=C(\C)c1csc(C2=CC=C(Cl)C(Cl)C=C2)c1O |
| InChI | InChI=1S/C13H11Cl2NOS/c1-7(16)9-6-18-13(12(9)17)8-2-4-10(14)11(15)5-3-8/h2-6,10,16-17H,1H3/b16-7+ |
| InChIKey | ZJCFATZRZFWLGO-FRKPEAEDSA-N |
| XLogP | 4.52 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|