C23H22ClNO3S2 — CID 159273449
1-[5-[2-[1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-methylbutan-1-one (PubChem CID 159273449) has the molecular formula C23H22ClNO3S2 and a molecular weight of 460.02 g/mol. Its IUPAC name is 1-[5-[2-[1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-methylbutan-1-one.
| Compound Name | 1-[5-[2-[1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 159273449 |
| Molecular Formula | C23H22ClNO3S2 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 1-[5-[2-[1-[5-(3-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]acetyl]thiophen-2-yl]-3-methylbutan-1-one |
| SMILES | C/C(=N\CC(=O)c1ccc(C(=O)CC(C)C)s1)c1csc(-c2cccc(Cl)c2)c1O |
| InChI | InChI=1S/C23H22ClNO3S2/c1-13(2)9-18(26)20-7-8-21(30-20)19(27)11-25-14(3)17-12-29-23(22(17)28)15-5-4-6-16(24)10-15/h4-8,10,12-13,28H,9,11H2,1-3H3/b25-14+ |
| InChIKey | XDLWRPYJZBXYPB-AFUMVMLFSA-N |
| XLogP | 6.76 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|