C20H18ClN3O4S2 — CID 59539326
2-N-[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(2-hydroxyethyl)thiophene-2,5-dicarboxamide (PubChem CID 59539326) has the molecular formula C20H18ClN3O4S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 2-N-[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(2-hydroxyethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(2-hydroxyethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 59539326 |
| Molecular Formula | C20H18ClN3O4S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-N-[(E)-1-[5-(4-chlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(2-hydroxyethyl)thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)NCCO)s1)c1csc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C20H18ClN3O4S2/c1-11(14-10-29-18(17(14)26)12-2-4-13(21)5-3-12)23-24-20(28)16-7-6-15(30-16)19(27)22-8-9-25/h2-7,10,25-26H,8-9H2,1H3,(H,22,27)(H,24,28)/b23-11+ |
| InChIKey | JCCVDMDQOUIYQI-FOKLQQMPSA-N |
| XLogP | 3.71 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|