C39H42N2O6S3 — CID 172837472
1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethanone;methyl 5-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylate (PubChem CID 172837472) has the molecular formula C39H42N2O6S3 and a molecular weight of 730.97 g/mol. Its IUPAC name is 1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethanone;methyl 5-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylate.
| Compound Name | 1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethanone;methyl 5-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 172837472 |
| Molecular Formula | C39H42N2O6S3 |
| Molecular Weight | 730.97 g/mol |
| Exact Mass | 730.22 |
| IUPAC Name | 1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethanone;methyl 5-[[1-[5-(4-tert-butylphenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carboxylate |
| SMILES | CC(=O)c1csc(-c2ccc(C(C)(C)C)cc2)c1O.COC(=O)c1ccc(C(=O)NN=C(C)c2csc(-c3ccc(C(C)(C)C)cc3)c2O)s1 |
| InChI | InChI=1S/C23H24N2O4S2.C16H18O2S/c1-13(24-25-21(27)17-10-11-18(31-17)22(28)29-5)16-12-30-20(19(16)26)14-6-8-15(9-7-14)23(2,3)4;1-10(17)13-9-19-15(14(13)18)11-5-7-12(8-6-11)16(2,3)4/h6-12,26H,1-5H3,(H,25,27);5-9,18H,1-4H3 |
| InChIKey | WIQJOLPAMUQSLW-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.97 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|