C23H22F3N3O3S2 — CID 73224811
2-N,2-N-diethyl-5-N-[1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide (PubChem CID 73224811) has the molecular formula C23H22F3N3O3S2 and a molecular weight of 509.58 g/mol. Its IUPAC name is 2-N,2-N-diethyl-5-N-[1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,2-N-diethyl-5-N-[1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 73224811 |
| Molecular Formula | C23H22F3N3O3S2 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 2-N,2-N-diethyl-5-N-[1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]thiophene-2,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)NN=C(C)c2csc(-c3ccc(C(F)(F)F)cc3)c2O)s1 |
| InChI | InChI=1S/C23H22F3N3O3S2/c1-4-29(5-2)22(32)18-11-10-17(34-18)21(31)28-27-13(3)16-12-33-20(19(16)30)14-6-8-15(9-7-14)23(24,25)26/h6-12,30H,4-5H2,1-3H3,(H,28,31) |
| InChIKey | YELAHAJPCOUBBF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|