C24H19BrN4O3S2 — CID 87263071
2-N-[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide (PubChem CID 87263071) has the molecular formula C24H19BrN4O3S2 and a molecular weight of 555.48 g/mol. Its IUPAC name is 2-N-[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 87263071 |
| Molecular Formula | C24H19BrN4O3S2 |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | 2-N-[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(C(=O)NCc2ccncc2)s1)c1csc(-c2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C24H19BrN4O3S2/c1-14(18-13-33-22(21(18)30)16-2-4-17(25)5-3-16)28-29-24(32)20-7-6-19(34-20)23(31)27-12-15-8-10-26-11-9-15/h2-11,13,30H,12H2,1H3,(H,27,31)(H,29,32)/b28-14- |
| InChIKey | QEJLDAMIDTWYGU-MUXKCCDJSA-N |
| XLogP | 5.42 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|