C25H26BrN5O2S2 — CID 87656872
1-[[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide (PubChem CID 87656872) has the molecular formula C25H26BrN5O2S2 and a molecular weight of 572.55 g/mol. Its IUPAC name is 1-[[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-[[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87656872 |
| Molecular Formula | C25H26BrN5O2S2 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | 1-[[(Z)-1-[5-(4-bromophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
| SMILES | C/C(=N/NC(=S)N1CCC(C(=O)NCc2ccncc2)CC1)c1csc(-c2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C25H26BrN5O2S2/c1-16(21-15-35-23(22(21)32)18-2-4-20(26)5-3-18)29-30-25(34)31-12-8-19(9-13-31)24(33)28-14-17-6-10-27-11-7-17/h2-7,10-11,15,19,32H,8-9,12-14H2,1H3,(H,28,33)(H,30,34)/b29-16- |
| InChIKey | JSYMVXWJWRCWSX-MWLSYYOVSA-N |
| XLogP | 4.91 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|