C27H28Cl2N4O3S2 — CID 76597814
N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)thiophene-2-carboxamide (PubChem CID 76597814) has the molecular formula C27H28Cl2N4O3S2 and a molecular weight of 591.59 g/mol. Its IUPAC name is N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 76597814 |
| Molecular Formula | C27H28Cl2N4O3S2 |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)thiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)N2CCC(N3CCCC3)CC2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C27H28Cl2N4O3S2/c1-16(19-15-37-25(24(19)34)17-4-5-20(28)21(29)14-17)30-31-26(35)22-6-7-23(38-22)27(36)33-12-8-18(9-13-33)32-10-2-3-11-32/h4-7,14-15,18,34H,2-3,8-13H2,1H3,(H,31,35) |
| InChIKey | KNHOWLZFEUUDMG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|