C22H19Cl2N3O5S2 — CID 76597778
3-[[5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carbonyl]-methylamino]propanoic acid (PubChem CID 76597778) has the molecular formula C22H19Cl2N3O5S2 and a molecular weight of 540.45 g/mol. Its IUPAC name is 3-[[5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carbonyl]-methylamino]propanoic acid.
| Compound Name | 3-[[5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 76597778 |
| Molecular Formula | C22H19Cl2N3O5S2 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | 3-[[5-[[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamoyl]thiophene-2-carbonyl]-methylamino]propanoic acid |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)N(C)CCC(=O)O)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C22H19Cl2N3O5S2/c1-11(13-10-33-20(19(13)30)12-3-4-14(23)15(24)9-12)25-26-21(31)16-5-6-17(34-16)22(32)27(2)8-7-18(28)29/h3-6,9-10,30H,7-8H2,1-2H3,(H,26,31)(H,28,29) |
| InChIKey | LYNAAWNQEZGGME-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|