C24H20Cl2N4O3S2 — CID 89385246
2-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(1,2-dihydropyridin-4-ylmethyl)thiophene-2,5-dicarboxamide (PubChem CID 89385246) has the molecular formula C24H20Cl2N4O3S2 and a molecular weight of 547.49 g/mol. Its IUPAC name is 2-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(1,2-dihydropyridin-4-ylmethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(1,2-dihydropyridin-4-ylmethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 89385246 |
| Molecular Formula | C24H20Cl2N4O3S2 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | 2-N-[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-5-N-(1,2-dihydropyridin-4-ylmethyl)thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)NCC2=CCNC=C2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C24H20Cl2N4O3S2/c1-13(16-12-34-22(21(16)31)15-2-3-17(25)18(26)10-15)29-30-24(33)20-5-4-19(35-20)23(32)28-11-14-6-8-27-9-7-14/h2-8,10,12,27,31H,9,11H2,1H3,(H,28,32)(H,30,33)/b29-13+ |
| InChIKey | BTMVSQVJCQIDKZ-VFLNYLIXSA-N |
| XLogP | 5.42 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|