About CID 159039825
CID 159039825 (PubChem CID 159039825) has the molecular formula C23H16Cl2KN4O3S2
and a molecular weight of 570.54 g/mol.
Molecular Properties
| Compound Name | CID 159039825 |
| PubChem CID | 159039825 |
| Molecular Formula | C23H16Cl2KN4O3S2 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 568.97 |
| IUPAC Name | — |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)Nc2cccnc2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O.[K] |
| InChI | InChI=1S/C23H16Cl2N4O3S2.K/c1-12(15-11-33-21(20(15)30)13-4-5-16(24)17(25)9-13)28-29-23(32)19-7-6-18(34-19)22(31)27-14-3-2-8-26-10-14;/h2-11,30H,1H3,(H,27,31)(H,29,32); |
| InChIKey | JVXLLJSYWZDGIU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 159039825 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159039825?
The IUPAC name of CID 159039825 (CID 159039825) is not available.
What is the SMILES notation for CID 159039825?
The canonical SMILES for CID 159039825 is CC(=NNC(=O)c1ccc(C(=O)Nc2cccnc2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O.[K].
What is the InChIKey of CID 159039825?
The InChIKey is JVXLLJSYWZDGIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16Cl2N4O3S2.K/c1-12(15-11-33-21(20(15)30)13-4-5-16(24)17(25)9-13)28-29-23(32)19-7-6-18(34-19)22(31)27-14-3-2-8-26-10-14;/h2-11,30H,1H3,(H,27,31)(H,29,32);.
What are the key properties of CID 159039825?
CID 159039825 has a molecular weight of 570.54 g/mol, XLogP of 5.91, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159039825 is sourced from PubChem (CID 159039825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).