C23H16Cl2KN4O3S2 — CID 159039825
CID 159039825 (PubChem CID 159039825) has the molecular formula C23H16Cl2KN4O3S2 and a molecular weight of 570.54 g/mol.
| Compound Name | CID 159039825 |
|---|---|
| PubChem CID | 159039825 |
| Molecular Formula | C23H16Cl2KN4O3S2 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 568.97 |
| IUPAC Name | — |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)Nc2cccnc2)s1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O.[K] |
| InChI | InChI=1S/C23H16Cl2N4O3S2.K/c1-12(15-11-33-21(20(15)30)13-4-5-16(24)17(25)9-13)28-29-23(32)19-7-6-18(34-19)22(31)27-14-3-2-8-26-10-14;/h2-11,30H,1H3,(H,27,31)(H,29,32); |
| InChIKey | JVXLLJSYWZDGIU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|