C20H14Cl2N4O3S — CID 86604761
N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide (PubChem CID 86604761) has the molecular formula C20H14Cl2N4O3S and a molecular weight of 461.33 g/mol. Its IUPAC name is N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide.
| Compound Name | N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 86604761 |
| Molecular Formula | C20H14Cl2N4O3S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | N-[1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-2-oxo-1,3-dihydrobenzimidazole-5-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc2[nH]c(=O)[nH]c2c1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C20H14Cl2N4O3S/c1-9(12-8-30-18(17(12)27)10-2-4-13(21)14(22)6-10)25-26-19(28)11-3-5-15-16(7-11)24-20(29)23-15/h2-8,27H,1H3,(H,26,28)(H2,23,24,29) |
| InChIKey | GHBVIAYFARXAQH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|