C21H16Cl2N4O3S2 — CID 16657097
1-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(3-oxo-4H-1,4-benzoxazin-6-yl)thiourea (PubChem CID 16657097) has the molecular formula C21H16Cl2N4O3S2 and a molecular weight of 507.42 g/mol. Its IUPAC name is 1-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(3-oxo-4H-1,4-benzoxazin-6-yl)thiourea.
| Compound Name | 1-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(3-oxo-4H-1,4-benzoxazin-6-yl)thiourea |
|---|---|
| PubChem CID | 16657097 |
| Molecular Formula | C21H16Cl2N4O3S2 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 1-[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]-3-(3-oxo-4H-1,4-benzoxazin-6-yl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1ccc2c(c1)NC(=O)CO2)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C21H16Cl2N4O3S2/c1-10(13-9-32-20(19(13)29)11-2-4-14(22)15(23)6-11)26-27-21(31)24-12-3-5-17-16(7-12)25-18(28)8-30-17/h2-7,9,29H,8H2,1H3,(H,25,28)(H2,24,27,31)/b26-10- |
| InChIKey | LKRKJFSUWNNYDT-KALUYTGESA-N |
| XLogP | 5.47 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|