C21H15ClF3N3O4S2 — CID 58636425
2-chloro-4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid (PubChem CID 58636425) has the molecular formula C21H15ClF3N3O4S2 and a molecular weight of 529.95 g/mol. Its IUPAC name is 2-chloro-4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 58636425 |
| Molecular Formula | C21H15ClF3N3O4S2 |
| Molecular Weight | 529.95 g/mol |
| Exact Mass | 529.01 |
| IUPAC Name | 2-chloro-4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethoxy)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]benzoic acid |
| SMILES | C/C(=N\NC(=S)Nc1ccc(C(=O)O)c(Cl)c1)c1csc(-c2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C21H15ClF3N3O4S2/c1-10(27-28-20(33)26-12-4-7-14(19(30)31)16(22)8-12)15-9-34-18(17(15)29)11-2-5-13(6-3-11)32-21(23,24)25/h2-9,29H,1H3,(H,30,31)(H2,26,28,33)/b27-10+ |
| InChIKey | YZHGEEJMYXGCNF-YPXUMCKCSA-N |
| XLogP | 6.08 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|