C25H28ClN5O3S — CID 87249864
methyl 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-chlorobenzoate (PubChem CID 87249864) has the molecular formula C25H28ClN5O3S and a molecular weight of 514.05 g/mol. Its IUPAC name is methyl 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-chlorobenzoate.
| Compound Name | methyl 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 87249864 |
| Molecular Formula | C25H28ClN5O3S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | methyl 4-[[1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-chlorobenzoate |
| SMILES | COC(=O)c1ccc(NC(=S)NN=C(C)c2nn(C)c(-c3ccc(C(C)(C)C)cc3)c2O)cc1Cl |
| InChI | InChI=1S/C25H28ClN5O3S/c1-14(28-29-24(35)27-17-11-12-18(19(26)13-17)23(33)34-6)20-22(32)21(31(5)30-20)15-7-9-16(10-8-15)25(2,3)4/h7-13,32H,1-6H3,(H2,27,29,35) |
| InChIKey | RCSGHFGYRKRVDJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|