C25H28N4O5 — CID 87249615
methyl 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-hydroxybenzoate (PubChem CID 87249615) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 87249615 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(C(=O)N/N=C(/C)c2nn(C)c(-c3ccc(C(C)(C)C)cc3)c2O)cc1O |
| InChI | InChI=1S/C25H28N4O5/c1-14(26-27-23(32)16-9-12-18(19(30)13-16)24(33)34-6)20-22(31)21(29(5)28-20)15-7-10-17(11-8-15)25(2,3)4/h7-13,30-31H,1-6H3,(H,27,32)/b26-14- |
| InChIKey | SBOVKVQFBADIND-WGARJPEWSA-N |
| XLogP | 3.74 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|