C20H16ClN5O6 — CID 59693276
4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid (PubChem CID 59693276) has the molecular formula C20H16ClN5O6 and a molecular weight of 457.83 g/mol. Its IUPAC name is 4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid.
| Compound Name | 4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 59693276 |
| Molecular Formula | C20H16ClN5O6 |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 4-[[(E)-1-[5-(4-chlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)O)c([N+](=O)[O-])c1)c1nn(C)c(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C20H16ClN5O6/c1-10(16-18(27)17(25(2)24-16)11-3-6-13(21)7-4-11)22-23-19(28)12-5-8-14(20(29)30)15(9-12)26(31)32/h3-9,27H,1-2H3,(H,23,28)(H,29,30)/b22-10+ |
| InChIKey | MVNZVIXROJRRLP-LSHDLFTRSA-N |
| XLogP | 3.21 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|