C20H15Cl2N5O6 — CID 87249686
4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid (PubChem CID 87249686) has the molecular formula C20H15Cl2N5O6 and a molecular weight of 492.28 g/mol. Its IUPAC name is 4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid.
| Compound Name | 4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 87249686 |
| Molecular Formula | C20H15Cl2N5O6 |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 4-[[(Z)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamoyl]-2-nitrobenzoic acid |
| SMILES | C/C(=N/NC(=O)c1ccc(C(=O)O)c([N+](=O)[O-])c1)c1nn(C)c(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C20H15Cl2N5O6/c1-9(16-18(28)17(26(2)25-16)10-4-6-13(21)14(22)7-10)23-24-19(29)11-3-5-12(20(30)31)15(8-11)27(32)33/h3-8,28H,1-2H3,(H,24,29)(H,30,31)/b23-9- |
| InChIKey | MSTZMRRJTPINKP-AQHIEDMUSA-N |
| XLogP | 3.86 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|