C18H15Cl2N5O3S2 — CID 59693162
5-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]thiophene-2-carboxylic acid (PubChem CID 59693162) has the molecular formula C18H15Cl2N5O3S2 and a molecular weight of 484.39 g/mol. Its IUPAC name is 5-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59693162 |
| Molecular Formula | C18H15Cl2N5O3S2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | 5-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]thiophene-2-carboxylic acid |
| SMILES | C/C(=N\NC(=S)Nc1ccc(C(=O)O)s1)c1nn(C)c(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C18H15Cl2N5O3S2/c1-8(22-23-18(29)21-13-6-5-12(30-13)17(27)28)14-16(26)15(25(2)24-14)9-3-4-10(19)11(20)7-9/h3-7,26H,1-2H3,(H,27,28)(H2,21,23,29)/b22-8+ |
| InChIKey | JDSGDQKBVAMQOH-GZIVZEMBSA-N |
| XLogP | 4.57 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|