C20H16Cl2N6O5S — CID 59693278
3-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-5-nitrobenzoic acid (PubChem CID 59693278) has the molecular formula C20H16Cl2N6O5S and a molecular weight of 523.36 g/mol. Its IUPAC name is 3-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-5-nitrobenzoic acid.
| Compound Name | 3-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 59693278 |
| Molecular Formula | C20H16Cl2N6O5S |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 3-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-5-nitrobenzoic acid |
| SMILES | C/C(=N\NC(=S)Nc1cc(C(=O)O)cc([N+](=O)[O-])c1)c1nn(C)c(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C20H16Cl2N6O5S/c1-9(16-18(29)17(27(2)26-16)10-3-4-14(21)15(22)7-10)24-25-20(34)23-12-5-11(19(30)31)6-13(8-12)28(32)33/h3-8,29H,1-2H3,(H,30,31)(H2,23,25,34)/b24-9+ |
| InChIKey | FTHYXOAMEBDPKS-PGGKNCGUSA-N |
| XLogP | 4.42 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|