C24H26N6O5S — CID 87249869
4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid (PubChem CID 87249869) has the molecular formula C24H26N6O5S and a molecular weight of 510.58 g/mol. Its IUPAC name is 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid.
| Compound Name | 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 87249869 |
| Molecular Formula | C24H26N6O5S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 4-[[(Z)-1-[5-(4-tert-butylphenyl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid |
| SMILES | C/C(=N/NC(=S)Nc1ccc(C(=O)O)c([N+](=O)[O-])c1)c1nn(C)c(-c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C24H26N6O5S/c1-13(26-27-23(36)25-16-10-11-17(22(32)33)18(12-16)30(34)35)19-21(31)20(29(5)28-19)14-6-8-15(9-7-14)24(2,3)4/h6-12,31H,1-5H3,(H,32,33)(H2,25,27,36)/b26-13- |
| InChIKey | WJPHYYFGERNKJM-ZMFRSBBQSA-N |
| XLogP | 4.41 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|