C21H15F3N4O5S2 — CID 59693185
4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid (PubChem CID 59693185) has the molecular formula C21H15F3N4O5S2 and a molecular weight of 524.50 g/mol. Its IUPAC name is 4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid.
| Compound Name | 4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 59693185 |
| Molecular Formula | C21H15F3N4O5S2 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 4-[[(E)-1-[4-hydroxy-5-[4-(trifluoromethyl)phenyl]thiophen-3-yl]ethylideneamino]carbamothioylamino]-2-nitrobenzoic acid |
| SMILES | C/C(=N\NC(=S)Nc1ccc(C(=O)O)c([N+](=O)[O-])c1)c1csc(-c2ccc(C(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C21H15F3N4O5S2/c1-10(15-9-35-18(17(15)29)11-2-4-12(5-3-11)21(22,23)24)26-27-20(34)25-13-6-7-14(19(30)31)16(8-13)28(32)33/h2-9,29H,1H3,(H,30,31)(H2,25,27,34)/b26-10+ |
| InChIKey | PYHVPWXLPHFZLN-NSKAYECMSA-N |
| XLogP | 5.46 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|